C26H20N2O5 — CID 108753917
3-[[3-(1,3-dihydrobenzo[f][1,3]benzoxazin-2-yl)benzoyl]amino]-4-hydroxybenzoic acid (PubChem CID 108753917) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 3-[[3-(1,3-dihydrobenzo[f][1,3]benzoxazin-2-yl)benzoyl]amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[[3-(1,3-dihydrobenzo[f][1,3]benzoxazin-2-yl)benzoyl]amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753917 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-[[3-(1,3-dihydrobenzo[f][1,3]benzoxazin-2-yl)benzoyl]amino]-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(NC(=O)c2cccc(N3COc4ccc5ccccc5c4C3)c2)c1 |
| InChI | InChI=1S/C26H20N2O5/c29-23-10-8-18(26(31)32)13-22(23)27-25(30)17-5-3-6-19(12-17)28-14-21-20-7-2-1-4-16(20)9-11-24(21)33-15-28/h1-13,29H,14-15H2,(H,27,30)(H,31,32) |
| InChIKey | PXNPYGQYUOJXPA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|