C18H17NO6 — CID 108753993
3-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-hydroxybenzoic acid (PubChem CID 108753993) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753993 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-hydroxybenzoic acid |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2cc(C(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C18H17NO6/c1-24-13-5-7-16(25-2)11(9-13)4-8-17(21)19-14-10-12(18(22)23)3-6-15(14)20/h3-10,20H,1-2H3,(H,19,21)(H,22,23)/b8-4+ |
| InChIKey | XQHYGIYWLDASKR-XBXARRHUSA-N |
| XLogP | 2.76 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|