About 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one
3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one (PubChem CID 108754007) has the molecular formula C24H26ClNO2
and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one |
| PubChem CID | 108754007 |
| Molecular Formula | C24H26ClNO2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCC2(C=Cc3cc(-c4ccccc4)ccc3O2)CC1 |
| InChI | InChI=1S/C24H26ClNO2/c1-23(2,17-25)22(27)26-14-12-24(13-15-26)11-10-20-16-19(8-9-21(20)28-24)18-6-4-3-5-7-18/h3-11,16H,12-15,17H2,1-2H3 |
| InChIKey | VDEQYBSWUBGBLP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one?
The IUPAC name of 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one (CID 108754007) is 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one.
What is the SMILES notation for 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one?
The canonical SMILES for 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one is CC(C)(CCl)C(=O)N1CCC2(C=Cc3cc(-c4ccccc4)ccc3O2)CC1.
What is the InChIKey of 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one?
The InChIKey is VDEQYBSWUBGBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26ClNO2/c1-23(2,17-25)22(27)26-14-12-24(13-15-26)11-10-20-16-19(8-9-21(20)28-24)18-6-4-3-5-7-18/h3-11,16H,12-15,17H2,1-2H3.
What are the key properties of 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one?
3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one has a molecular weight of 395.93 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,2-dimethyl-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propan-1-one is sourced from PubChem (CID 108754007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).