C17H18N2O5 — CID 108755443
ethyl 2-[(2,6-dimethoxybenzoyl)amino]pyridine-4-carboxylate (PubChem CID 108755443) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is ethyl 2-[(2,6-dimethoxybenzoyl)amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[(2,6-dimethoxybenzoyl)amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 108755443 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | ethyl 2-[(2,6-dimethoxybenzoyl)amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C17H18N2O5/c1-4-24-17(21)11-8-9-18-14(10-11)19-16(20)15-12(22-2)6-5-7-13(15)23-3/h5-10H,4H2,1-3H3,(H,18,19,20) |
| InChIKey | CRGKJWNHJQFACY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |