C19H22N2O5 — CID 108755781
trans-(1S,2R)-2-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 108755781) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is trans-(1S,2R)-2-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2R)-2-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 108755781 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | trans-(1S,2R)-2-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C(=O)NC[C@@H]1CCCC[C@@H]1C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22N2O5/c1-11(21-17(23)14-8-4-5-9-15(14)18(21)24)16(22)20-10-12-6-2-3-7-13(12)19(25)26/h4-5,8-9,11-13H,2-3,6-7,10H2,1H3,(H,20,22)(H,25,26)/t11?,12-,13-/m0/s1 |
| InChIKey | SVUHVIVUPKKBCL-SPOOISQMSA-N |
| XLogP | 1.68 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|