C20H38 — CID 10875610
6,7-dibutyldodeca-5,7-diene (PubChem CID 10875610) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is 6,7-dibutyldodeca-5,7-diene.
| Compound Name | 6,7-dibutyldodeca-5,7-diene |
|---|---|
| PubChem CID | 10875610 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 6,7-dibutyldodeca-5,7-diene |
| SMILES | CCCCC=C(CCCC)C(=CCCCC)CCCC |
| InChI | InChI=1S/C20H38/c1-5-9-13-17-19(15-11-7-3)20(16-12-8-4)18-14-10-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | KFUJYKGCPKORDM-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|