C26H23ClN4OS — CID 108756734
(Z)-N-[5-[(2-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-2,3-diphenylprop-2-enamide (PubChem CID 108756734) has the molecular formula C26H23ClN4OS and a molecular weight of 475.02 g/mol. Its IUPAC name is (Z)-N-[5-[(2-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[5-[(2-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 108756734 |
| Molecular Formula | C26H23ClN4OS |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (Z)-N-[5-[(2-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]-2,3-diphenylprop-2-enamide |
| SMILES | CCn1c(NC(=O)/C(=C\c2ccccc2)c2ccccc2)nnc1SCc1ccccc1Cl |
| InChI | InChI=1S/C26H23ClN4OS/c1-2-31-25(29-30-26(31)33-18-21-15-9-10-16-23(21)27)28-24(32)22(20-13-7-4-8-14-20)17-19-11-5-3-6-12-19/h3-17H,2,18H2,1H3,(H,28,29,32)/b22-17- |
| InChIKey | ZMRNUDDIMRAMNR-XLNRJJMWSA-N |
| XLogP | 6.42 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|