About CID 10875803
CID 10875803 (PubChem CID 10875803) has the molecular formula C16H25O
and a molecular weight of 233.38 g/mol.
Molecular Properties
| Compound Name | CID 10875803 |
| PubChem CID | 10875803 |
| Molecular Formula | C16H25O |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCC(=O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C16H25O/c1-2-3-4-5-6-7-8-9-14-16(17)15-12-10-11-13-15/h10-13H,2-9,14H2,1H3 |
| InChIKey | CMSLUBAYCAKSID-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 10875803 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10875803?
The IUPAC name of CID 10875803 (CID 10875803) is not available.
What is the SMILES notation for CID 10875803?
The canonical SMILES for CID 10875803 is CCCCCCCCCCC(=O)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 10875803?
The InChIKey is CMSLUBAYCAKSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25O/c1-2-3-4-5-6-7-8-9-14-16(17)15-12-10-11-13-15/h10-13H,2-9,14H2,1H3.
What are the key properties of CID 10875803?
CID 10875803 has a molecular weight of 233.38 g/mol, XLogP of 4.49, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10875803 is sourced from PubChem (CID 10875803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).