C26H36FNO16 — CID 10875954
[(2R,3R,4S,5R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,6-diacetyloxy-5-fluorooxan-2-yl]methyl acetate (PubChem CID 10875954) has the molecular formula C26H36FNO16 and a molecular weight of 637.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,6-diacetyloxy-5-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,6-diacetyloxy-5-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10875954 |
| Molecular Formula | C26H36FNO16 |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | [(2R,3R,4S,5R)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,6-diacetyloxy-5-fluorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](O[C@H]2[C@H](OC(C)=O)[C@@H](F)C(OC(C)=O)O[C@@H]2COC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H36FNO16/c1-10(29)28-20-24(40-15(6)34)22(38-13(4)32)18(9-37-12(3)31)43-26(20)44-21-17(8-36-11(2)30)42-25(41-16(7)35)19(27)23(21)39-14(5)33/h17-26H,8-9H2,1-7H3,(H,28,29)/t17-,18-,19-,20-,21-,22-,23-,24-,25?,26+/m1/s1 |
| InChIKey | UQVIKPLULLMAJX-VRPAFYEKSA-N |
| XLogP | -0.85 |
| TPSA | 214.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|