C24H25ClN4O2 — CID 108759860
2-(4-chlorophenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 108759860) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-chlorophenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 108759860 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1nc(-c2ccccc2)cc(N2CCN(C(=O)C(C)Oc3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-17(31-21-10-8-20(25)9-11-21)24(30)29-14-12-28(13-15-29)23-16-22(26-18(2)27-23)19-6-4-3-5-7-19/h3-11,16-17H,12-15H2,1-2H3 |
| InChIKey | YCJJZELIMKQQGX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |