C8H11BrN2OS — CID 108760194
2-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 108760194) has the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. Its IUPAC name is 2-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 2-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 108760194 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 2-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | Cc1nc(CNC(=O)C(C)Br)cs1 |
| InChI | InChI=1S/C8H11BrN2OS/c1-5(9)8(12)10-3-7-4-13-6(2)11-7/h4-5H,3H2,1-2H3,(H,10,12) |
| InChIKey | GMAYVYLOUMXAHJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|