C18H11Cl2N5O — CID 108760966
(E)-N-(4-cyano-1-pyridin-2-ylpyrazol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 108760966) has the molecular formula C18H11Cl2N5O and a molecular weight of 384.23 g/mol. Its IUPAC name is (E)-N-(4-cyano-1-pyridin-2-ylpyrazol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-cyano-1-pyridin-2-ylpyrazol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108760966 |
| Molecular Formula | C18H11Cl2N5O |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (E)-N-(4-cyano-1-pyridin-2-ylpyrazol-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#Cc1cnn(-c2ccccn2)c1NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H11Cl2N5O/c19-14-6-4-12(9-15(14)20)5-7-17(26)24-18-13(10-21)11-23-25(18)16-3-1-2-8-22-16/h1-9,11H,(H,24,26)/b7-5+ |
| InChIKey | JAKWAWSYDUHDKE-FNORWQNLSA-N |
| XLogP | 4.10 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|