C21H31N3O2 — CID 108762046
1-tert-butyl-5-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 108762046) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-tert-butyl-5-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-5-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108762046 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-tert-butyl-5-oxo-N-[4-(piperidin-1-ylmethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)N1CC(C(=O)Nc2ccc(CN3CCCCC3)cc2)CC1=O |
| InChI | InChI=1S/C21H31N3O2/c1-21(2,3)24-15-17(13-19(24)25)20(26)22-18-9-7-16(8-10-18)14-23-11-5-4-6-12-23/h7-10,17H,4-6,11-15H2,1-3H3,(H,22,26) |
| InChIKey | AJLWXOQIZSENDR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |