C37H48N4OP+ — CID 10876218
4,5,9,10,14,15,19,20-octaethyl-22-hydroxy-22-methyl-21,23,24,25-tetraza-22-phosphoniahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1(20),2,4,6(25),7,9,11,13(24),14,16,18-undecaene (PubChem CID 10876218) has the molecular formula C37H48N4OP+ and a molecular weight of 595.79 g/mol. Its IUPAC name is 4,5,9,10,14,15,19,20-octaethyl-22-hydroxy-22-methyl-21,23,24,25-tetraza-22-phosphoniahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1(20),2,4,6(25),7,9,11,13(24),14,16,18-undecaene.
| Compound Name | 4,5,9,10,14,15,19,20-octaethyl-22-hydroxy-22-methyl-21,23,24,25-tetraza-22-phosphoniahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1(20),2,4,6(25),7,9,11,13(24),14,16,18-undecaene |
|---|---|
| PubChem CID | 10876218 |
| Molecular Formula | C37H48N4OP+ |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.36 |
| IUPAC Name | 4,5,9,10,14,15,19,20-octaethyl-22-hydroxy-22-methyl-21,23,24,25-tetraza-22-phosphoniahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1(20),2,4,6(25),7,9,11,13(24),14,16,18-undecaene |
| SMILES | CCC1=C(CC)/C2=C/c3c(CC)c(CC)c4n3[P+](C)(O)n3/c(c(CC)c(CC)/c3=C/C3=N/C(=C\4)C(CC)=C3CC)=C\C1=N2 |
| InChI | InChI=1S/C37H48N4OP/c1-10-22-23(11-2)31-19-35-28(16-7)29(17-8)37-21-33-25(13-4)24(12-3)32(39-33)20-36-27(15-6)26(14-5)34(18-30(22)38-31)40(36)43(9,42)41(35)37/h18-21,42H,10-17H2,1-9H3/q+1/b30-18-,31-19-,32-20-,33-21-,34-18-,35-19-,36-20-,37-21- |
| InChIKey | CEJVDQAJYPHZCH-RZBFMZLGSA-N |
| XLogP | 7.73 |
| TPSA | 54.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|