C23H22N4O3 — CID 108762237
2-[1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 108762237) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108762237 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCC(c2nc3ccccc3[nH]2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22N4O3/c1-14(27-22(29)16-6-2-3-7-17(16)23(27)30)21(28)26-12-10-15(11-13-26)20-24-18-8-4-5-9-19(18)25-20/h2-9,14-15H,10-13H2,1H3,(H,24,25) |
| InChIKey | BEQLHOLFMLNPGV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|