C50H53NO8 — CID 10876511
(4R)-4-benzyl-3-[(2R)-2-[[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 10876511) has the molecular formula C50H53NO8 and a molecular weight of 795.97 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R)-2-[[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R)-2-[[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10876511 |
| Molecular Formula | C50H53NO8 |
| Molecular Weight | 795.97 g/mol |
| Exact Mass | 795.38 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R)-2-[[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCC(C[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C50H53NO8/c1-2-18-42(49(52)51-43(35-58-50(51)53)29-37-19-8-3-9-20-37)30-44-46(55-32-39-23-12-5-13-24-39)48(57-34-41-27-16-7-17-28-41)47(56-33-40-25-14-6-15-26-40)45(59-44)36-54-31-38-21-10-4-11-22-38/h2-17,19-28,42-48H,1,18,29-36H2/t42?,43-,44+,45-,46+,47+,48-/m1/s1 |
| InChIKey | VWOHPECAGKMMHA-GBUXZTCFSA-N |
| XLogP | 8.90 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.97 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|