C44H48FN6O6P — CID 10876541
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[di(propan-2-yl)amino]-fluorophosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 10876541) has the molecular formula C44H48FN6O6P and a molecular weight of 806.88 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[di(propan-2-yl)amino]-fluorophosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[di(propan-2-yl)amino]-fluorophosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10876541 |
| Molecular Formula | C44H48FN6O6P |
| Molecular Weight | 806.88 g/mol |
| Exact Mass | 806.34 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[di(propan-2-yl)amino]-fluorophosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2OP(F)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H48FN6O6P/c1-29(2)51(30(3)4)58(45)57-37-25-39(50-28-48-40-41(46-27-47-42(40)50)49-43(52)31-13-9-7-10-14-31)56-38(37)26-55-44(32-15-11-8-12-16-32,33-17-21-35(53-5)22-18-33)34-19-23-36(54-6)24-20-34/h7-24,27-30,37-39H,25-26H2,1-6H3,(H,46,47,49,52)/t37-,38+,39+,58?/m0/s1 |
| InChIKey | OSBCWVBXMJWPGX-CNGLVTPWSA-N |
| XLogP | 9.09 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.88 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|