C24H26N2O2 — CID 108767365
N-[2-(4-methylanilino)phenyl]-2-(2,3,6-trimethylphenoxy)acetamide (PubChem CID 108767365) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[2-(4-methylanilino)phenyl]-2-(2,3,6-trimethylphenoxy)acetamide.
| Compound Name | N-[2-(4-methylanilino)phenyl]-2-(2,3,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 108767365 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[2-(4-methylanilino)phenyl]-2-(2,3,6-trimethylphenoxy)acetamide |
| SMILES | Cc1ccc(Nc2ccccc2NC(=O)COc2c(C)ccc(C)c2C)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-16-9-13-20(14-10-16)25-21-7-5-6-8-22(21)26-23(27)15-28-24-18(3)12-11-17(2)19(24)4/h5-14,25H,15H2,1-4H3,(H,26,27) |
| InChIKey | BORCKYFSMYBFKK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |