C18H23BrClNO4 — CID 108767593
methyl 2-[[2-(2-bromo-4-chlorophenoxy)propanoylamino]methyl]cyclohexane-1-carboxylate (PubChem CID 108767593) has the molecular formula C18H23BrClNO4 and a molecular weight of 432.74 g/mol. Its IUPAC name is methyl 2-[[2-(2-bromo-4-chlorophenoxy)propanoylamino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[2-(2-bromo-4-chlorophenoxy)propanoylamino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108767593 |
| Molecular Formula | C18H23BrClNO4 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | methyl 2-[[2-(2-bromo-4-chlorophenoxy)propanoylamino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)C(C)Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C18H23BrClNO4/c1-11(25-16-8-7-13(20)9-15(16)19)17(22)21-10-12-5-3-4-6-14(12)18(23)24-2/h7-9,11-12,14H,3-6,10H2,1-2H3,(H,21,22) |
| InChIKey | YGQSAPOTPIUOMQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |