C27H22N6O3 — CID 108769496
2-tert-butyl-N-[4-cyano-1-(4-methylquinolin-2-yl)pyrazol-5-yl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108769496) has the molecular formula C27H22N6O3 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-cyano-1-(4-methylquinolin-2-yl)pyrazol-5-yl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[4-cyano-1-(4-methylquinolin-2-yl)pyrazol-5-yl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108769496 |
| Molecular Formula | C27H22N6O3 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-tert-butyl-N-[4-cyano-1-(4-methylquinolin-2-yl)pyrazol-5-yl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1cc(-n2ncc(C#N)c2NC(=O)c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)nc2ccccc12 |
| InChI | InChI=1S/C27H22N6O3/c1-15-11-22(30-21-8-6-5-7-18(15)21)33-23(17(13-28)14-29-33)31-24(34)16-9-10-19-20(12-16)26(36)32(25(19)35)27(2,3)4/h5-12,14H,1-4H3,(H,31,34) |
| InChIKey | VHIRPDASRVYZTP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|