About spiro[2.3]hexan-6-one
spiro[2.3]hexan-6-one (PubChem CID 10877057) has the molecular formula C6H8O
and a molecular weight of 96.13 g/mol. Its IUPAC name is spiro[2.3]hexan-6-one.
Molecular Properties
| Compound Name | spiro[2.3]hexan-6-one |
| PubChem CID | 10877057 |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.06 |
| IUPAC Name | spiro[2.3]hexan-6-one |
| SMILES | O=C1CCC12CC2 |
| InChI | InChI=1S/C6H8O/c7-5-1-2-6(5)3-4-6/h1-4H2 |
| InChIKey | OIRNAOWGCPSZCJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2.3]hexan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.3]hexan-6-one?
The IUPAC name of spiro[2.3]hexan-6-one (CID 10877057) is spiro[2.3]hexan-6-one.
What is the SMILES notation for spiro[2.3]hexan-6-one?
The canonical SMILES for spiro[2.3]hexan-6-one is O=C1CCC12CC2.
What is the InChIKey of spiro[2.3]hexan-6-one?
The InChIKey is OIRNAOWGCPSZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O/c7-5-1-2-6(5)3-4-6/h1-4H2.
What are the key properties of spiro[2.3]hexan-6-one?
spiro[2.3]hexan-6-one has a molecular weight of 96.13 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.3]hexan-6-one is sourced from PubChem (CID 10877057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).