C25H28N6OS — CID 108771461
1-[2-[(3,4-dimethyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-3-methylbutan-1-one (PubChem CID 108771461) has the molecular formula C25H28N6OS and a molecular weight of 460.61 g/mol. Its IUPAC name is 1-[2-[(3,4-dimethyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-3-methylbutan-1-one.
| Compound Name | 1-[2-[(3,4-dimethyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 108771461 |
| Molecular Formula | C25H28N6OS |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[2-[(3,4-dimethyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-3-methylbutan-1-one |
| SMILES | Cc1cc(Nc2nc3c(s2)CN(C(=O)CC(C)C)CC3)nc2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C25H28N6OS/c1-15(2)12-22(32)30-11-10-19-20(14-30)33-25(26-19)28-21-13-16(3)23-17(4)29-31(24(23)27-21)18-8-6-5-7-9-18/h5-9,13,15H,10-12,14H2,1-4H3,(H,26,27,28) |
| InChIKey | MZBSJLVNFJJDOW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |