C13H10ClN5S2 — CID 108772191
6-chloro-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 108772191) has the molecular formula C13H10ClN5S2 and a molecular weight of 335.85 g/mol. Its IUPAC name is 6-chloro-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 108772191 |
| Molecular Formula | C13H10ClN5S2 |
| Molecular Weight | 335.85 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 6-chloro-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1sc2nc(Nc3nc4ccc(Cl)cc4s3)nn2c1C |
| InChI | InChI=1S/C13H10ClN5S2/c1-6-7(2)20-13-17-11(18-19(6)13)16-12-15-9-4-3-8(14)5-10(9)21-12/h3-5H,1-2H3,(H,15,16,18) |
| InChIKey | ICMCXMFJNPEYOV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |