About 2-butyl-2-methyloxolane
2-butyl-2-methyloxolane (PubChem CID 10877221) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2-butyl-2-methyloxolane.
Molecular Properties
| Compound Name | 2-butyl-2-methyloxolane |
| PubChem CID | 10877221 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2-butyl-2-methyloxolane |
| SMILES | CCCCC1(C)CCCO1 |
| InChI | InChI=1S/C9H18O/c1-3-4-6-9(2)7-5-8-10-9/h3-8H2,1-2H3 |
| InChIKey | OYMSVJQGHGHEMZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-methyloxolane?
The IUPAC name of 2-butyl-2-methyloxolane (CID 10877221) is 2-butyl-2-methyloxolane.
What is the SMILES notation for 2-butyl-2-methyloxolane?
The canonical SMILES for 2-butyl-2-methyloxolane is CCCCC1(C)CCCO1.
What is the InChIKey of 2-butyl-2-methyloxolane?
The InChIKey is OYMSVJQGHGHEMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-4-6-9(2)7-5-8-10-9/h3-8H2,1-2H3.
What are the key properties of 2-butyl-2-methyloxolane?
2-butyl-2-methyloxolane has a molecular weight of 142.24 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-methyloxolane is sourced from PubChem (CID 10877221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).