C16H11ClN8O3S — CID 108772677
N-[4-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]phenyl]acetamide (PubChem CID 108772677) has the molecular formula C16H11ClN8O3S and a molecular weight of 430.84 g/mol. Its IUPAC name is N-[4-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]phenyl]acetamide.
| Compound Name | N-[4-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108772677 |
| Molecular Formula | C16H11ClN8O3S |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[4-[2-[(6-chloro-5-nitropyrimidin-4-yl)amino]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc3nc(Nc4ncnc(Cl)c4[N+](=O)[O-])nn23)cc1 |
| InChI | InChI=1S/C16H11ClN8O3S/c1-8(26)20-10-4-2-9(3-5-10)11-6-29-16-22-15(23-24(11)16)21-14-12(25(27)28)13(17)18-7-19-14/h2-7H,1H3,(H,20,26)(H,18,19,21,23) |
| InChIKey | MQADKDCBTNKVHX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|