About 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine]
1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] (PubChem CID 108773061) has the molecular formula C25H24ClN3O
and a molecular weight of 417.94 g/mol. Its IUPAC name is 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine].
Molecular Properties
| Compound Name | 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] |
| PubChem CID | 108773061 |
| Molecular Formula | C25H24ClN3O |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] |
| SMILES | CCc1nc(Cl)cc(N2CCC3(C=Cc4cc(-c5ccccc5)ccc4O3)CC2)n1 |
| InChI | InChI=1S/C25H24ClN3O/c1-2-23-27-22(26)17-24(28-23)29-14-12-25(13-15-29)11-10-20-16-19(8-9-21(20)30-25)18-6-4-3-5-7-18/h3-11,16-17H,2,12-15H2,1H3 |
| InChIKey | LVVWETGKDOXZQJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine]?
The IUPAC name of 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] (CID 108773061) is 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine].
What is the SMILES notation for 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine]?
The canonical SMILES for 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] is CCc1nc(Cl)cc(N2CCC3(C=Cc4cc(-c5ccccc5)ccc4O3)CC2)n1.
What is the InChIKey of 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine]?
The InChIKey is LVVWETGKDOXZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClN3O/c1-2-23-27-22(26)17-24(28-23)29-14-12-25(13-15-29)11-10-20-16-19(8-9-21(20)30-25)18-6-4-3-5-7-18/h3-11,16-17H,2,12-15H2,1H3.
What are the key properties of 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine]?
1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] has a molecular weight of 417.94 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(6-chloro-2-ethylpyrimidin-4-yl)-6-phenylspiro[chromene-2,4'-piperidine] is sourced from PubChem (CID 108773061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).