About 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline
2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline (PubChem CID 108773340) has the molecular formula C22H23N5
and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline.
Molecular Properties
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline |
| PubChem CID | 108773340 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline |
| SMILES | Cc1cc(N2CCN(c3nc4ccccc4[nH]3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C22H23N5/c1-15-6-5-7-17-16(2)14-20(25-21(15)17)26-10-12-27(13-11-26)22-23-18-8-3-4-9-19(18)24-22/h3-9,14H,10-13H2,1-2H3,(H,23,24) |
| InChIKey | CMZRECMUBSYSMK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline?
The IUPAC name of 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline (CID 108773340) is 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline.
What is the SMILES notation for 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline?
The canonical SMILES for 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline is Cc1cc(N2CCN(c3nc4ccccc4[nH]3)CC2)nc2c(C)cccc12.
What is the InChIKey of 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline?
The InChIKey is CMZRECMUBSYSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5/c1-15-6-5-7-17-16(2)14-20(25-21(15)17)26-10-12-27(13-11-26)22-23-18-8-3-4-9-19(18)24-22/h3-9,14H,10-13H2,1-2H3,(H,23,24).
What are the key properties of 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline?
2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline has a molecular weight of 357.46 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-4,8-dimethylquinoline is sourced from PubChem (CID 108773340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).