C21H25N7 — CID 108773538
2-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]-3-pyrrolidin-1-ylquinoxaline (PubChem CID 108773538) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is 2-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]-3-pyrrolidin-1-ylquinoxaline.
| Compound Name | 2-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]-3-pyrrolidin-1-ylquinoxaline |
|---|---|
| PubChem CID | 108773538 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]-3-pyrrolidin-1-ylquinoxaline |
| SMILES | Cc1cc(N2CCN(c3nc4ccccc4nc3N3CCCC3)CC2)ncn1 |
| InChI | InChI=1S/C21H25N7/c1-16-14-19(23-15-22-16)26-10-12-28(13-11-26)21-20(27-8-4-5-9-27)24-17-6-2-3-7-18(17)25-21/h2-3,6-7,14-15H,4-5,8-13H2,1H3 |
| InChIKey | BGHOYUZCXUEAIW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |