C15H10N8O4S — CID 108773843
2-[[5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione (PubChem CID 108773843) has the molecular formula C15H10N8O4S and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-[[5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108773843 |
| Molecular Formula | C15H10N8O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[[5-[(6-amino-5-nitropyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
| SMILES | Nc1ncnc(Nc2nnc(CN3C(=O)c4ccccc4C3=O)s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10N8O4S/c16-11-10(23(26)27)12(18-6-17-11)19-15-21-20-9(28-15)5-22-13(24)7-3-1-2-4-8(7)14(22)25/h1-4,6H,5H2,(H3,16,17,18,19,21) |
| InChIKey | QNZHRPDCYUVIKK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 170.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|