About N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine
N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine (PubChem CID 108773944) has the molecular formula C12H12N6S
and a molecular weight of 272.34 g/mol. Its IUPAC name is N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine.
Molecular Properties
| Compound Name | N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine |
| PubChem CID | 108773944 |
| Molecular Formula | C12H12N6S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine |
| SMILES | CCSc1n[nH]c(Nc2cnc3ccccc3n2)n1 |
| InChI | InChI=1S/C12H12N6S/c1-2-19-12-16-11(17-18-12)15-10-7-13-8-5-3-4-6-9(8)14-10/h3-7H,2H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | KWAJHIIRBSSMDU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine?
The IUPAC name of N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine (CID 108773944) is N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine.
What is the SMILES notation for N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine?
The canonical SMILES for N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine is CCSc1n[nH]c(Nc2cnc3ccccc3n2)n1.
What is the InChIKey of N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine?
The InChIKey is KWAJHIIRBSSMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6S/c1-2-19-12-16-11(17-18-12)15-10-7-13-8-5-3-4-6-9(8)14-10/h3-7H,2H2,1H3,(H2,14,15,16,17,18).
What are the key properties of N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine?
N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine has a molecular weight of 272.34 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)quinoxalin-2-amine is sourced from PubChem (CID 108773944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).