About 2-methyloctane-1,8-diamine
2-methyloctane-1,8-diamine (PubChem CID 10877399) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is 2-methyloctane-1,8-diamine.
Molecular Properties
| Compound Name | 2-methyloctane-1,8-diamine |
| PubChem CID | 10877399 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 2-methyloctane-1,8-diamine |
| SMILES | CC(CN)CCCCCCN |
| InChI | InChI=1S/C9H22N2/c1-9(8-11)6-4-2-3-5-7-10/h9H,2-8,10-11H2,1H3 |
| InChIKey | GAGWMWLBYJPFDD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctane-1,8-diamine?
The IUPAC name of 2-methyloctane-1,8-diamine (CID 10877399) is 2-methyloctane-1,8-diamine.
What is the SMILES notation for 2-methyloctane-1,8-diamine?
The canonical SMILES for 2-methyloctane-1,8-diamine is CC(CN)CCCCCCN.
What is the InChIKey of 2-methyloctane-1,8-diamine?
The InChIKey is GAGWMWLBYJPFDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2/c1-9(8-11)6-4-2-3-5-7-10/h9H,2-8,10-11H2,1H3.
What are the key properties of 2-methyloctane-1,8-diamine?
2-methyloctane-1,8-diamine has a molecular weight of 158.29 g/mol, XLogP of 1.49, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctane-1,8-diamine is sourced from PubChem (CID 10877399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).