C21H18N8 — CID 108775648
1-pyridin-2-yl-5-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]pyrazole-4-carbonitrile (PubChem CID 108775648) has the molecular formula C21H18N8 and a molecular weight of 382.43 g/mol. Its IUPAC name is 1-pyridin-2-yl-5-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]pyrazole-4-carbonitrile.
| Compound Name | 1-pyridin-2-yl-5-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108775648 |
| Molecular Formula | C21H18N8 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-pyridin-2-yl-5-[(3-pyrrolidin-1-ylquinoxalin-2-yl)amino]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ccccn2)c1Nc1nc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C21H18N8/c22-13-15-14-24-29(18-9-3-4-10-23-18)20(15)27-19-21(28-11-5-6-12-28)26-17-8-2-1-7-16(17)25-19/h1-4,7-10,14H,5-6,11-12H2,(H,25,27) |
| InChIKey | GKNPDHWONQCULE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |