About 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol
1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol (PubChem CID 10877701) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol.
Analyze 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol?
The IUPAC name of 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol (CID 10877701) is 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol.
What is the SMILES notation for 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol?
The canonical SMILES for 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol is Cc1nc2c(c(C)c1O)CCN2C.
What is the InChIKey of 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol?
The InChIKey is GDUBMBRHFKQUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-6-8-4-5-12(3)10(8)11-7(2)9(6)13/h13H,4-5H2,1-3H3.
What are the key properties of 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol?
1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol has a molecular weight of 178.23 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-ol is sourced from PubChem (CID 10877701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).