C16H22N2O3S — CID 108777969
4-ethylsulfanyl-2-[(5-propan-2-yl-1,3-benzoxazol-2-yl)amino]butanoic acid (PubChem CID 108777969) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-ethylsulfanyl-2-[(5-propan-2-yl-1,3-benzoxazol-2-yl)amino]butanoic acid.
| Compound Name | 4-ethylsulfanyl-2-[(5-propan-2-yl-1,3-benzoxazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 108777969 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-ethylsulfanyl-2-[(5-propan-2-yl-1,3-benzoxazol-2-yl)amino]butanoic acid |
| SMILES | CCSCCC(Nc1nc2cc(C(C)C)ccc2o1)C(=O)O |
| InChI | InChI=1S/C16H22N2O3S/c1-4-22-8-7-12(15(19)20)17-16-18-13-9-11(10(2)3)5-6-14(13)21-16/h5-6,9-10,12H,4,7-8H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | ZIXHRHGTLQMOJI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|