About 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide
3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide (PubChem CID 10877831) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide.
Molecular Properties
| Compound Name | 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide |
| PubChem CID | 10877831 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide |
| SMILES | CNC(=O)CC(=O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C8H14N2O3/c1-9-8(13)3-7(12)6-2-5(11)4-10-6/h5-6,10-11H,2-4H2,1H3,(H,9,13)/t5-,6+/m1/s1 |
| InChIKey | DEHAGJAHRGQQJA-RITPCOANSA-N |
| XLogP | -1.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide?
The IUPAC name of 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide (CID 10877831) is 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide.
What is the SMILES notation for 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide?
The canonical SMILES for 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide is CNC(=O)CC(=O)[C@@H]1C[C@@H](O)CN1.
What is the InChIKey of 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide?
The InChIKey is DEHAGJAHRGQQJA-RITPCOANSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-9-8(13)3-7(12)6-2-5(11)4-10-6/h5-6,10-11H,2-4H2,1H3,(H,9,13)/t5-,6+/m1/s1.
What are the key properties of 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide?
3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide has a molecular weight of 186.21 g/mol, XLogP of -1.59, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,4R)-4-hydroxypyrrolidin-2-yl]-N-methyl-3-oxopropanamide is sourced from PubChem (CID 10877831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).