C15H11ClN6S — CID 108778534
4-(chloromethyl)-N-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 108778534) has the molecular formula C15H11ClN6S and a molecular weight of 342.82 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(chloromethyl)-N-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 108778534 |
| Molecular Formula | C15H11ClN6S |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-(chloromethyl)-N-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | ClCc1csc(Nc2ncnc3c2cnn3-c2ccccc2)n1 |
| InChI | InChI=1S/C15H11ClN6S/c16-6-10-8-23-15(20-10)21-13-12-7-19-22(14(12)18-9-17-13)11-4-2-1-3-5-11/h1-5,7-9H,6H2,(H,17,18,20,21) |
| InChIKey | MUVOXMDPHRKEOA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|