C9H16O4 — CID 10877885
cis-ethyl (1R,3R)-2,2-dimethoxy-3-methylcyclopropane-1-carboxylate (PubChem CID 10877885) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is cis-ethyl (1R,3R)-2,2-dimethoxy-3-methylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,3R)-2,2-dimethoxy-3-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10877885 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | cis-ethyl (1R,3R)-2,2-dimethoxy-3-methylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C)C1(OC)OC |
| InChI | InChI=1S/C9H16O4/c1-5-13-8(10)7-6(2)9(7,11-3)12-4/h6-7H,5H2,1-4H3/t6-,7+/m1/s1 |
| InChIKey | BRQVWVDQCXJKSK-RQJHMYQMSA-N |
| XLogP | 0.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|