About 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole
2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole (PubChem CID 10877953) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 10877953 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccccc1C1=NCCN1 |
| InChI | InChI=1S/C9H9N3O2/c13-12(14)8-4-2-1-3-7(8)9-10-5-6-11-9/h1-4H,5-6H2,(H,10,11) |
| InChIKey | OMMRAZUBECEXDI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole (CID 10877953) is 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole is O=[N+]([O-])c1ccccc1C1=NCCN1.
What is the InChIKey of 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole?
The InChIKey is OMMRAZUBECEXDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c13-12(14)8-4-2-1-3-7(8)9-10-5-6-11-9/h1-4H,5-6H2,(H,10,11).
What are the key properties of 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole?
2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole has a molecular weight of 191.19 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10877953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).