C17H13N5S — CID 108780009
N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]quinoxalin-2-amine (PubChem CID 108780009) has the molecular formula C17H13N5S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]quinoxalin-2-amine.
| Compound Name | N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 108780009 |
| Molecular Formula | C17H13N5S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]quinoxalin-2-amine |
| SMILES | c1ccc2nc(NCc3csc(-c4ccncc4)n3)cnc2c1 |
| InChI | InChI=1S/C17H13N5S/c1-2-4-15-14(3-1)19-10-16(22-15)20-9-13-11-23-17(21-13)12-5-7-18-8-6-12/h1-8,10-11H,9H2,(H,20,22) |
| InChIKey | SIIDWYNHHDFGBH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |