C20H22N6O2 — CID 108780035
ethyl 6-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]anilino]pyridazine-3-carboxylate (PubChem CID 108780035) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is ethyl 6-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]anilino]pyridazine-3-carboxylate.
| Compound Name | ethyl 6-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]anilino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 108780035 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethyl 6-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]anilino]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Nc2cc(Nc3cc(C)ncn3)ccc2CC)nn1 |
| InChI | InChI=1S/C20H22N6O2/c1-4-14-6-7-15(23-19-10-13(3)21-12-22-19)11-17(14)24-18-9-8-16(25-26-18)20(27)28-5-2/h6-12H,4-5H2,1-3H3,(H,24,26)(H,21,22,23) |
| InChIKey | BQACJJYBWAMISX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |