C20H24N4OS2 — CID 108780201
1-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-cyclohexylthiourea (PubChem CID 108780201) has the molecular formula C20H24N4OS2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-cyclohexylthiourea.
| Compound Name | 1-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 108780201 |
| Molecular Formula | C20H24N4OS2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-(5-benzoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-cyclohexylthiourea |
| SMILES | O=C(c1ccccc1)N1CCc2nc(NC(=S)NC3CCCCC3)sc2C1 |
| InChI | InChI=1S/C20H24N4OS2/c25-18(14-7-3-1-4-8-14)24-12-11-16-17(13-24)27-20(22-16)23-19(26)21-15-9-5-2-6-10-15/h1,3-4,7-8,15H,2,5-6,9-13H2,(H2,21,22,23,26) |
| InChIKey | GPUFLJURRXLCOJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|