About 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole
1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole (PubChem CID 10878060) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole |
| PubChem CID | 10878060 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole |
| SMILES | Cn1ncc2c1CNC2 |
| InChI | InChI=1S/C6H9N3/c1-9-6-4-7-2-5(6)3-8-9/h3,7H,2,4H2,1H3 |
| InChIKey | ZPRTZMMXOLTYSI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
The IUPAC name of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole (CID 10878060) is 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole.
What is the SMILES notation for 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
The canonical SMILES for 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole is Cn1ncc2c1CNC2.
What is the InChIKey of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
The InChIKey is ZPRTZMMXOLTYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-9-6-4-7-2-5(6)3-8-9/h3,7H,2,4H2,1H3.
What are the key properties of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole has a molecular weight of 123.16 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 10878060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).