C13H16N4O2S2 — CID 108780877
2-[4-(benzenesulfonyl)piperazin-1-yl]-5-methyl-1,3,4-thiadiazole (PubChem CID 108780877) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 108780877 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2CCN(S(=O)(=O)c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-11-14-15-13(20-11)16-7-9-17(10-8-16)21(18,19)12-5-3-2-4-6-12/h2-6H,7-10H2,1H3 |
| InChIKey | MNMLIPJWVNXWCV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |