About 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione
1,3-di(propan-2-yl)imidazolidine-2,4,5-trione (PubChem CID 10878121) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione.
Molecular Properties
| Compound Name | 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione |
| PubChem CID | 10878121 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione |
| SMILES | CC(C)N1C(=O)C(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C9H14N2O3/c1-5(2)10-7(12)8(13)11(6(3)4)9(10)14/h5-6H,1-4H3 |
| InChIKey | YJOSPGTWCMUJSJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione?
The IUPAC name of 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione (CID 10878121) is 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione.
What is the SMILES notation for 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione?
The canonical SMILES for 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione is CC(C)N1C(=O)C(=O)N(C(C)C)C1=O.
What is the InChIKey of 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione?
The InChIKey is YJOSPGTWCMUJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-5(2)10-7(12)8(13)11(6(3)4)9(10)14/h5-6H,1-4H3.
What are the key properties of 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione?
1,3-di(propan-2-yl)imidazolidine-2,4,5-trione has a molecular weight of 198.22 g/mol, XLogP of 0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(propan-2-yl)imidazolidine-2,4,5-trione is sourced from PubChem (CID 10878121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).