C4HClF6 — CID 10878139
(E)-2-chloro-1,1,1,4,4,4-hexafluorobut-2-ene (PubChem CID 10878139) has the molecular formula C4HClF6 and a molecular weight of 198.49 g/mol. Its IUPAC name is (E)-2-chloro-1,1,1,4,4,4-hexafluorobut-2-ene.
| Compound Name | (E)-2-chloro-1,1,1,4,4,4-hexafluorobut-2-ene |
|---|---|
| PubChem CID | 10878139 |
| Molecular Formula | C4HClF6 |
| Molecular Weight | 198.49 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | (E)-2-chloro-1,1,1,4,4,4-hexafluorobut-2-ene |
| SMILES | FC(F)(F)/C=C(/Cl)C(F)(F)F |
| InChI | InChI=1S/C4HClF6/c5-2(4(9,10)11)1-3(6,7)8/h1H/b2-1+ |
| InChIKey | JRENXZBKMHPULY-OWOJBTEDSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |