C24H19N3O7S — CID 108781667
methyl 4-cyano-5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-2-methylfuran-3-carboxylate (PubChem CID 108781667) has the molecular formula C24H19N3O7S and a molecular weight of 493.50 g/mol. Its IUPAC name is methyl 4-cyano-5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 4-cyano-5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108781667 |
| Molecular Formula | C24H19N3O7S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | methyl 4-cyano-5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NS(=O)(=O)c2ccc(CCN3C(=O)c4ccccc4C3=O)cc2)c1C#N |
| InChI | InChI=1S/C24H19N3O7S/c1-14-20(24(30)33-2)19(13-25)21(34-14)26-35(31,32)16-9-7-15(8-10-16)11-12-27-22(28)17-5-3-4-6-18(17)23(27)29/h3-10,26H,11-12H2,1-2H3 |
| InChIKey | IJPBZVOZRPVVKP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|