C25H22N2O5S — CID 108781699
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzenesulfonamide (PubChem CID 108781699) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzenesulfonamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 108781699 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methyl-3,4-dihydro-2H-chromen-4-yl)benzenesulfonamide |
| SMILES | Cc1ccc2c(c1)C(NS(=O)(=O)c1ccc(CN3C(=O)c4ccccc4C3=O)cc1)CCO2 |
| InChI | InChI=1S/C25H22N2O5S/c1-16-6-11-23-21(14-16)22(12-13-32-23)26-33(30,31)18-9-7-17(8-10-18)15-27-24(28)19-4-2-3-5-20(19)25(27)29/h2-11,14,22,26H,12-13,15H2,1H3 |
| InChIKey | DQKSRWLUKPPGHT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|