C14H23N — CID 10878296
(5R,8R,8aS)-8-methyl-5-pent-4-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 10878296) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (5R,8R,8aS)-8-methyl-5-pent-4-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (5R,8R,8aS)-8-methyl-5-pent-4-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 10878296 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (5R,8R,8aS)-8-methyl-5-pent-4-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C#CCCC[C@@H]1CC[C@@H](C)[C@@H]2CCCN12 |
| InChI | InChI=1S/C14H23N/c1-3-4-5-7-13-10-9-12(2)14-8-6-11-15(13)14/h1,12-14H,4-11H2,2H3/t12-,13-,14+/m1/s1 |
| InChIKey | ZZXULMJOWKRHSL-MCIONIFRSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|