About 5-(3-nitrophenyl)-1,3-thiazole
5-(3-nitrophenyl)-1,3-thiazole (PubChem CID 10878300) has the molecular formula C9H6N2O2S
and a molecular weight of 206.23 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(3-nitrophenyl)-1,3-thiazole |
| PubChem CID | 10878300 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 5-(3-nitrophenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2cncs2)c1 |
| InChI | InChI=1S/C9H6N2O2S/c12-11(13)8-3-1-2-7(4-8)9-5-10-6-14-9/h1-6H |
| InChIKey | RJEDZWJSLKNZRU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-nitrophenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-nitrophenyl)-1,3-thiazole?
The IUPAC name of 5-(3-nitrophenyl)-1,3-thiazole (CID 10878300) is 5-(3-nitrophenyl)-1,3-thiazole.
What is the SMILES notation for 5-(3-nitrophenyl)-1,3-thiazole?
The canonical SMILES for 5-(3-nitrophenyl)-1,3-thiazole is O=[N+]([O-])c1cccc(-c2cncs2)c1.
What is the InChIKey of 5-(3-nitrophenyl)-1,3-thiazole?
The InChIKey is RJEDZWJSLKNZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2S/c12-11(13)8-3-1-2-7(4-8)9-5-10-6-14-9/h1-6H.
What are the key properties of 5-(3-nitrophenyl)-1,3-thiazole?
5-(3-nitrophenyl)-1,3-thiazole has a molecular weight of 206.23 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-nitrophenyl)-1,3-thiazole is sourced from PubChem (CID 10878300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).