C20H16N4O4S — CID 108783886
4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 108783886) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 108783886 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(C(=O)O)cc2)n(-c2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C20H16N4O4S/c1-13-12-19(23-29(27,28)16-9-6-15(7-10-16)20(25)26)24(22-13)18-11-8-14-4-2-3-5-17(14)21-18/h2-12,23H,1H3,(H,25,26) |
| InChIKey | HNSXVMLYSSZZMP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |